C19H27N3O — CID 70736382
[1-[(1-ethylbenzimidazol-2-yl)methyl]-3-prop-2-enylpiperidin-3-yl]methanol (PubChem CID 70736382) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is [1-[(1-ethylbenzimidazol-2-yl)methyl]-3-prop-2-enylpiperidin-3-yl]methanol.
| Compound Name | [1-[(1-ethylbenzimidazol-2-yl)methyl]-3-prop-2-enylpiperidin-3-yl]methanol |
|---|---|
| PubChem CID | 70736382 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | [1-[(1-ethylbenzimidazol-2-yl)methyl]-3-prop-2-enylpiperidin-3-yl]methanol |
| SMILES | C=CCC1(CO)CCCN(Cc2nc3ccccc3n2CC)C1 |
| InChI | InChI=1S/C19H27N3O/c1-3-10-19(15-23)11-7-12-21(14-19)13-18-20-16-8-5-6-9-17(16)22(18)4-2/h3,5-6,8-9,23H,1,4,7,10-15H2,2H3 |
| InChIKey | RNJNMOUIFSQQSL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|