C21H31N5 — CID 56743242
1,9-dimethyl-4-[(1-prop-2-enylbenzimidazol-2-yl)methyl]-1,4,9-triazaspiro[5.5]undecane (PubChem CID 56743242) has the molecular formula C21H31N5 and a molecular weight of 353.51 g/mol. Its IUPAC name is 1,9-dimethyl-4-[(1-prop-2-enylbenzimidazol-2-yl)methyl]-1,4,9-triazaspiro[5.5]undecane.
| Compound Name | 1,9-dimethyl-4-[(1-prop-2-enylbenzimidazol-2-yl)methyl]-1,4,9-triazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 56743242 |
| Molecular Formula | C21H31N5 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | 1,9-dimethyl-4-[(1-prop-2-enylbenzimidazol-2-yl)methyl]-1,4,9-triazaspiro[5.5]undecane |
| SMILES | C=CCn1c(CN2CCN(C)C3(CCN(C)CC3)C2)nc2ccccc21 |
| InChI | InChI=1S/C21H31N5/c1-4-11-26-19-8-6-5-7-18(19)22-20(26)16-25-15-14-24(3)21(17-25)9-12-23(2)13-10-21/h4-8H,1,9-17H2,2-3H3 |
| InChIKey | UPNKTPUNGYEQCS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 27.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|