C23H30N4O — CID 70715822
1-methyl-10-prop-2-enyl-4-(quinolin-4-ylmethyl)-1,4,10-triazaspiro[5.6]dodecan-9-one (PubChem CID 70715822) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-methyl-10-prop-2-enyl-4-(quinolin-4-ylmethyl)-1,4,10-triazaspiro[5.6]dodecan-9-one.
| Compound Name | 1-methyl-10-prop-2-enyl-4-(quinolin-4-ylmethyl)-1,4,10-triazaspiro[5.6]dodecan-9-one |
|---|---|
| PubChem CID | 70715822 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 1-methyl-10-prop-2-enyl-4-(quinolin-4-ylmethyl)-1,4,10-triazaspiro[5.6]dodecan-9-one |
| SMILES | C=CCN1CCC2(CCC1=O)CN(Cc1ccnc3ccccc13)CCN2C |
| InChI | InChI=1S/C23H30N4O/c1-3-13-27-14-11-23(10-8-22(27)28)18-26(16-15-25(23)2)17-19-9-12-24-21-7-5-4-6-20(19)21/h3-7,9,12H,1,8,10-11,13-18H2,2H3 |
| InChIKey | WBXZVISWHDRWME-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|