C23H35N3O2 — CID 70718122
4-[2-(3,4-dimethylphenoxy)ethyl]-1-methyl-10-prop-2-enyl-1,4,10-triazaspiro[5.6]dodecan-9-one (PubChem CID 70718122) has the molecular formula C23H35N3O2 and a molecular weight of 385.55 g/mol. Its IUPAC name is 4-[2-(3,4-dimethylphenoxy)ethyl]-1-methyl-10-prop-2-enyl-1,4,10-triazaspiro[5.6]dodecan-9-one.
| Compound Name | 4-[2-(3,4-dimethylphenoxy)ethyl]-1-methyl-10-prop-2-enyl-1,4,10-triazaspiro[5.6]dodecan-9-one |
|---|---|
| PubChem CID | 70718122 |
| Molecular Formula | C23H35N3O2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | 4-[2-(3,4-dimethylphenoxy)ethyl]-1-methyl-10-prop-2-enyl-1,4,10-triazaspiro[5.6]dodecan-9-one |
| SMILES | C=CCN1CCC2(CCC1=O)CN(CCOc1ccc(C)c(C)c1)CCN2C |
| InChI | InChI=1S/C23H35N3O2/c1-5-11-26-12-10-23(9-8-22(26)27)18-25(14-13-24(23)4)15-16-28-21-7-6-19(2)20(3)17-21/h5-7,17H,1,8-16,18H2,2-4H3 |
| InChIKey | APYYVFOWSVFFRT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|