C21H32N4O — CID 98809259
(6R)-4-[(5-ethyl-2-pyridinyl)methyl]-1-methyl-10-prop-2-enyl-1,4,10-triazaspiro[5.6]dodecan-9-one (PubChem CID 98809259) has the molecular formula C21H32N4O and a molecular weight of 356.51 g/mol. Its IUPAC name is (6R)-4-[(5-ethyl-2-pyridinyl)methyl]-1-methyl-10-prop-2-enyl-1,4,10-triazaspiro[5.6]dodecan-9-one.
| Compound Name | (6R)-4-[(5-ethyl-2-pyridinyl)methyl]-1-methyl-10-prop-2-enyl-1,4,10-triazaspiro[5.6]dodecan-9-one |
|---|---|
| PubChem CID | 98809259 |
| Molecular Formula | C21H32N4O |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.26 |
| IUPAC Name | (6R)-4-[(5-ethyl-2-pyridinyl)methyl]-1-methyl-10-prop-2-enyl-1,4,10-triazaspiro[5.6]dodecan-9-one |
| SMILES | C=CCN1CC[C@]2(CCC1=O)CN(Cc1ccc(CC)cn1)CCN2C |
| InChI | InChI=1S/C21H32N4O/c1-4-11-25-12-10-21(9-8-20(25)26)17-24(14-13-23(21)3)16-19-7-6-18(5-2)15-22-19/h4,6-7,15H,1,5,8-14,16-17H2,2-3H3/t21-/m1/s1 |
| InChIKey | JYIVXSJXFLDAAC-OAQYLSRUSA-N |
| XLogP | 2.33 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|