C22H33N3O — CID 97132773
(6S)-1-methyl-4-(3-phenylpropyl)-10-prop-2-enyl-1,4,10-triazaspiro[5.6]dodecan-9-one (PubChem CID 97132773) has the molecular formula C22H33N3O and a molecular weight of 355.53 g/mol. Its IUPAC name is (6S)-1-methyl-4-(3-phenylpropyl)-10-prop-2-enyl-1,4,10-triazaspiro[5.6]dodecan-9-one.
| Compound Name | (6S)-1-methyl-4-(3-phenylpropyl)-10-prop-2-enyl-1,4,10-triazaspiro[5.6]dodecan-9-one |
|---|---|
| PubChem CID | 97132773 |
| Molecular Formula | C22H33N3O |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.26 |
| IUPAC Name | (6S)-1-methyl-4-(3-phenylpropyl)-10-prop-2-enyl-1,4,10-triazaspiro[5.6]dodecan-9-one |
| SMILES | C=CCN1CC[C@@]2(CCC1=O)CN(CCCc1ccccc1)CCN2C |
| InChI | InChI=1S/C22H33N3O/c1-3-14-25-16-13-22(12-11-21(25)26)19-24(18-17-23(22)2)15-7-10-20-8-5-4-6-9-20/h3-6,8-9H,1,7,10-19H2,2H3/t22-/m0/s1 |
| InChIKey | AFZUBISXOAAOSJ-QFIPXVFZSA-N |
| XLogP | 2.80 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|