C21H33N3O2 — CID 70722921
1,10-dimethyl-4-(3-phenylmethoxypropyl)-1,4,10-triazaspiro[5.6]dodecan-9-one (PubChem CID 70722921) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is 1,10-dimethyl-4-(3-phenylmethoxypropyl)-1,4,10-triazaspiro[5.6]dodecan-9-one.
| Compound Name | 1,10-dimethyl-4-(3-phenylmethoxypropyl)-1,4,10-triazaspiro[5.6]dodecan-9-one |
|---|---|
| PubChem CID | 70722921 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | 1,10-dimethyl-4-(3-phenylmethoxypropyl)-1,4,10-triazaspiro[5.6]dodecan-9-one |
| SMILES | CN1CCC2(CCC1=O)CN(CCCOCc1ccccc1)CCN2C |
| InChI | InChI=1S/C21H33N3O2/c1-22-13-11-21(10-9-20(22)25)18-24(15-14-23(21)2)12-6-16-26-17-19-7-4-3-5-8-19/h3-5,7-8H,6,9-18H2,1-2H3 |
| InChIKey | RIIQCATWLGQEDD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|