C21H30N4O2 — CID 97130965
(6R)-N,1-dimethyl-9-oxo-N-phenyl-10-prop-2-enyl-1,4,10-triazaspiro[5.6]dodecane-4-carboxamide (PubChem CID 97130965) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is (6R)-N,1-dimethyl-9-oxo-N-phenyl-10-prop-2-enyl-1,4,10-triazaspiro[5.6]dodecane-4-carboxamide.
| Compound Name | (6R)-N,1-dimethyl-9-oxo-N-phenyl-10-prop-2-enyl-1,4,10-triazaspiro[5.6]dodecane-4-carboxamide |
|---|---|
| PubChem CID | 97130965 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | (6R)-N,1-dimethyl-9-oxo-N-phenyl-10-prop-2-enyl-1,4,10-triazaspiro[5.6]dodecane-4-carboxamide |
| SMILES | C=CCN1CC[C@]2(CCC1=O)CN(C(=O)N(C)c1ccccc1)CCN2C |
| InChI | InChI=1S/C21H30N4O2/c1-4-13-24-14-12-21(11-10-19(24)26)17-25(16-15-22(21)2)20(27)23(3)18-8-6-5-7-9-18/h4-9H,1,10-17H2,2-3H3/t21-/m1/s1 |
| InChIKey | IZKKENYTPAZEIS-OAQYLSRUSA-N |
| XLogP | 2.43 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|