C19H28N4O2S — CID 70737784
1-methyl-9-oxo-10-prop-2-enyl-N-(thiophen-2-ylmethyl)-1,4,10-triazaspiro[5.6]dodecane-4-carboxamide (PubChem CID 70737784) has the molecular formula C19H28N4O2S and a molecular weight of 376.53 g/mol. Its IUPAC name is 1-methyl-9-oxo-10-prop-2-enyl-N-(thiophen-2-ylmethyl)-1,4,10-triazaspiro[5.6]dodecane-4-carboxamide.
| Compound Name | 1-methyl-9-oxo-10-prop-2-enyl-N-(thiophen-2-ylmethyl)-1,4,10-triazaspiro[5.6]dodecane-4-carboxamide |
|---|---|
| PubChem CID | 70737784 |
| Molecular Formula | C19H28N4O2S |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 1-methyl-9-oxo-10-prop-2-enyl-N-(thiophen-2-ylmethyl)-1,4,10-triazaspiro[5.6]dodecane-4-carboxamide |
| SMILES | C=CCN1CCC2(CCC1=O)CN(C(=O)NCc1cccs1)CCN2C |
| InChI | InChI=1S/C19H28N4O2S/c1-3-9-22-10-8-19(7-6-17(22)24)15-23(12-11-21(19)2)18(25)20-14-16-5-4-13-26-16/h3-5,13H,1,6-12,14-15H2,2H3,(H,20,25) |
| InChIKey | KMYBKQAHTVZKBN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|