C20H29N5O — CID 72857942
4-(6-cyclopropylpyrimidin-4-yl)-1-methyl-10-prop-2-enyl-1,4,10-triazaspiro[5.6]dodecan-9-one (PubChem CID 72857942) has the molecular formula C20H29N5O and a molecular weight of 355.49 g/mol. Its IUPAC name is 4-(6-cyclopropylpyrimidin-4-yl)-1-methyl-10-prop-2-enyl-1,4,10-triazaspiro[5.6]dodecan-9-one.
| Compound Name | 4-(6-cyclopropylpyrimidin-4-yl)-1-methyl-10-prop-2-enyl-1,4,10-triazaspiro[5.6]dodecan-9-one |
|---|---|
| PubChem CID | 72857942 |
| Molecular Formula | C20H29N5O |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | 4-(6-cyclopropylpyrimidin-4-yl)-1-methyl-10-prop-2-enyl-1,4,10-triazaspiro[5.6]dodecan-9-one |
| SMILES | C=CCN1CCC2(CCC1=O)CN(c1cc(C3CC3)ncn1)CCN2C |
| InChI | InChI=1S/C20H29N5O/c1-3-9-24-10-8-20(7-6-19(24)26)14-25(12-11-23(20)2)18-13-17(16-4-5-16)21-15-22-18/h3,13,15-16H,1,4-12,14H2,2H3 |
| InChIKey | PTNDUWGCWARCKS-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|