C17H21N3O3 — CID 133125273
(2S,4R)-4-hydroxy-1-[(1-prop-2-enylbenzimidazol-2-yl)methyl]piperidine-2-carboxylic acid (PubChem CID 133125273) has the molecular formula C17H21N3O3 and a molecular weight of 315.37 g/mol. Its IUPAC name is (2S,4R)-4-hydroxy-1-[(1-prop-2-enylbenzimidazol-2-yl)methyl]piperidine-2-carboxylic acid.
| Compound Name | (2S,4R)-4-hydroxy-1-[(1-prop-2-enylbenzimidazol-2-yl)methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 133125273 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | (2S,4R)-4-hydroxy-1-[(1-prop-2-enylbenzimidazol-2-yl)methyl]piperidine-2-carboxylic acid |
| SMILES | C=CCn1c(CN2CC[C@@H](O)C[C@H]2C(=O)O)nc2ccccc21 |
| InChI | InChI=1S/C17H21N3O3/c1-2-8-20-14-6-4-3-5-13(14)18-16(20)11-19-9-7-12(21)10-15(19)17(22)23/h2-6,12,15,21H,1,7-11H2,(H,22,23)/t12-,15+/m1/s1 |
| InChIKey | DNTSSYVOOKBWOH-DOMZBBRYSA-N |
| XLogP | 1.63 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|