C17H27N3O2 — CID 97136190
(3S)-1-[(2-butyl-1H-imidazol-5-yl)methyl]-3-prop-2-enylpiperidine-3-carboxylic acid (PubChem CID 97136190) has the molecular formula C17H27N3O2 and a molecular weight of 305.42 g/mol. Its IUPAC name is (3S)-1-[(2-butyl-1H-imidazol-5-yl)methyl]-3-prop-2-enylpiperidine-3-carboxylic acid.
| Compound Name | (3S)-1-[(2-butyl-1H-imidazol-5-yl)methyl]-3-prop-2-enylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97136190 |
| Molecular Formula | C17H27N3O2 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | (3S)-1-[(2-butyl-1H-imidazol-5-yl)methyl]-3-prop-2-enylpiperidine-3-carboxylic acid |
| SMILES | C=CC[C@@]1(C(=O)O)CCCN(Cc2cnc(CCCC)[nH]2)C1 |
| InChI | InChI=1S/C17H27N3O2/c1-3-5-7-15-18-11-14(19-15)12-20-10-6-9-17(13-20,8-4-2)16(21)22/h4,11H,2-3,5-10,12-13H2,1H3,(H,18,19)(H,21,22)/t17-/m1/s1 |
| InChIKey | PYAKIJAKCVGJDX-QGZVFWFLSA-N |
| XLogP | 3.00 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|