C18H26N4O2S — CID 56906121
1-(benzenesulfonyl)-4-[(2-butyl-1H-imidazol-5-yl)methyl]piperazine (PubChem CID 56906121) has the molecular formula C18H26N4O2S and a molecular weight of 362.50 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-[(2-butyl-1H-imidazol-5-yl)methyl]piperazine.
| Compound Name | 1-(benzenesulfonyl)-4-[(2-butyl-1H-imidazol-5-yl)methyl]piperazine |
|---|---|
| PubChem CID | 56906121 |
| Molecular Formula | C18H26N4O2S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 1-(benzenesulfonyl)-4-[(2-butyl-1H-imidazol-5-yl)methyl]piperazine |
| SMILES | CCCCc1ncc(CN2CCN(S(=O)(=O)c3ccccc3)CC2)[nH]1 |
| InChI | InChI=1S/C18H26N4O2S/c1-2-3-9-18-19-14-16(20-18)15-21-10-12-22(13-11-21)25(23,24)17-7-5-4-6-8-17/h4-8,14H,2-3,9-13,15H2,1H3,(H,19,20) |
| InChIKey | AYNZYDQJFBAWMQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |