C17H24N4O2S — CID 56883312
1-(benzenesulfonyl)-4-[(1-propylimidazol-2-yl)methyl]piperazine (PubChem CID 56883312) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-[(1-propylimidazol-2-yl)methyl]piperazine.
| Compound Name | 1-(benzenesulfonyl)-4-[(1-propylimidazol-2-yl)methyl]piperazine |
|---|---|
| PubChem CID | 56883312 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-(benzenesulfonyl)-4-[(1-propylimidazol-2-yl)methyl]piperazine |
| SMILES | CCCn1ccnc1CN1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C17H24N4O2S/c1-2-9-20-10-8-18-17(20)15-19-11-13-21(14-12-19)24(22,23)16-6-4-3-5-7-16/h3-8,10H,2,9,11-15H2,1H3 |
| InChIKey | RCZLATUJSOOICJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |