C21H30ClN5 — CID 70780165
(3aS,6aS)-5-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-1-[(6-methyl-2-pyridinyl)methyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole (PubChem CID 70780165) has the molecular formula C21H30ClN5 and a molecular weight of 387.96 g/mol. Its IUPAC name is (3aS,6aS)-5-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-1-[(6-methyl-2-pyridinyl)methyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole.
| Compound Name | (3aS,6aS)-5-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-1-[(6-methyl-2-pyridinyl)methyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 70780165 |
| Molecular Formula | C21H30ClN5 |
| Molecular Weight | 387.96 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | (3aS,6aS)-5-[(2-butyl-4-chloro-1H-imidazol-5-yl)methyl]-1-[(6-methyl-2-pyridinyl)methyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
| SMILES | CCCCc1nc(Cl)c(CN2C[C@@H]3CCN(Cc4cccc(C)n4)[C@@H]3C2)[nH]1 |
| InChI | InChI=1S/C21H30ClN5/c1-3-4-8-20-24-18(21(22)25-20)13-26-11-16-9-10-27(19(16)14-26)12-17-7-5-6-15(2)23-17/h5-7,16,19H,3-4,8-14H2,1-2H3,(H,24,25)/t16-,19+/m0/s1 |
| InChIKey | MXNNKXYOMJWNAP-QFBILLFUSA-N |
| XLogP | 3.82 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.96 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |