C17H21N5 — CID 97386512
(3aS,6aS)-1-[(6-methyl-2-pyridinyl)methyl]-4-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole (PubChem CID 97386512) has the molecular formula C17H21N5 and a molecular weight of 295.39 g/mol. Its IUPAC name is (3aS,6aS)-1-[(6-methyl-2-pyridinyl)methyl]-4-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole.
| Compound Name | (3aS,6aS)-1-[(6-methyl-2-pyridinyl)methyl]-4-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 97386512 |
| Molecular Formula | C17H21N5 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | (3aS,6aS)-1-[(6-methyl-2-pyridinyl)methyl]-4-pyrimidin-2-yl-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
| SMILES | Cc1cccc(CN2CC[C@H]3[C@@H]2CCN3c2ncccn2)n1 |
| InChI | InChI=1S/C17H21N5/c1-13-4-2-5-14(20-13)12-21-10-6-16-15(21)7-11-22(16)17-18-8-3-9-19-17/h2-5,8-9,15-16H,6-7,10-12H2,1H3/t15-,16-/m0/s1 |
| InChIKey | JURDHVGAHBNIKR-HOTGVXAUSA-N |
| XLogP | 2.03 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |