C16H24N4O — CID 125220159
(3aS,6aR)-N,N-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide (PubChem CID 125220159) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is (3aS,6aR)-N,N-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide.
| Compound Name | (3aS,6aR)-N,N-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 125220159 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | (3aS,6aR)-N,N-dimethyl-1-[(6-methyl-2-pyridinyl)methyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide |
| SMILES | Cc1cccc(CN2CC[C@H]3[C@H]2CCN3C(=O)N(C)C)n1 |
| InChI | InChI=1S/C16H24N4O/c1-12-5-4-6-13(17-12)11-19-9-7-15-14(19)8-10-20(15)16(21)18(2)3/h4-6,14-15H,7-11H2,1-3H3/t14-,15+/m1/s1 |
| InChIKey | UPYFHEXVSGMFFP-CABCVRRESA-N |
| XLogP | 1.72 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |