C19H21F3N4 — CID 163346011
1-[(6-methyl-2-pyridinyl)methyl]-5-[4-(trifluoromethyl)-2-pyridinyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole (PubChem CID 163346011) has the molecular formula C19H21F3N4 and a molecular weight of 362.40 g/mol. Its IUPAC name is 1-[(6-methyl-2-pyridinyl)methyl]-5-[4-(trifluoromethyl)-2-pyridinyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole.
| Compound Name | 1-[(6-methyl-2-pyridinyl)methyl]-5-[4-(trifluoromethyl)-2-pyridinyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
|---|---|
| PubChem CID | 163346011 |
| Molecular Formula | C19H21F3N4 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 1-[(6-methyl-2-pyridinyl)methyl]-5-[4-(trifluoromethyl)-2-pyridinyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole |
| SMILES | Cc1cccc(CN2CCC3CN(c4cc(C(F)(F)F)ccn4)CC32)n1 |
| InChI | InChI=1S/C19H21F3N4/c1-13-3-2-4-16(24-13)11-25-8-6-14-10-26(12-17(14)25)18-9-15(5-7-23-18)19(20,21)22/h2-5,7,9,14,17H,6,8,10-12H2,1H3 |
| InChIKey | QSHDJNBAFIZHMY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |