C18H21F3N4S — CID 163349217
2,4-dimethyl-5-[[5-[4-(trifluoromethyl)-2-pyridinyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]methyl]-1,3-thiazole (PubChem CID 163349217) has the molecular formula C18H21F3N4S and a molecular weight of 382.46 g/mol. Its IUPAC name is 2,4-dimethyl-5-[[5-[4-(trifluoromethyl)-2-pyridinyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]methyl]-1,3-thiazole.
| Compound Name | 2,4-dimethyl-5-[[5-[4-(trifluoromethyl)-2-pyridinyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 163349217 |
| Molecular Formula | C18H21F3N4S |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2,4-dimethyl-5-[[5-[4-(trifluoromethyl)-2-pyridinyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]methyl]-1,3-thiazole |
| SMILES | Cc1nc(C)c(CN2CCC3CN(c4cc(C(F)(F)F)ccn4)CC32)s1 |
| InChI | InChI=1S/C18H21F3N4S/c1-11-16(26-12(2)23-11)10-24-6-4-13-8-25(9-15(13)24)17-7-14(3-5-22-17)18(19,20)21/h3,5,7,13,15H,4,6,8-10H2,1-2H3 |
| InChIKey | RRTYLIGWUMJXCH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |