C15H29NO2 — CID 162036909
(5R)-1-butyl-5-[(E)-4-hydroxypent-1-enyl]pyrrolidin-2-one;ethane (PubChem CID 162036909) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is (5R)-1-butyl-5-[(E)-4-hydroxypent-1-enyl]pyrrolidin-2-one;ethane.
| Compound Name | (5R)-1-butyl-5-[(E)-4-hydroxypent-1-enyl]pyrrolidin-2-one;ethane |
|---|---|
| PubChem CID | 162036909 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | (5R)-1-butyl-5-[(E)-4-hydroxypent-1-enyl]pyrrolidin-2-one;ethane |
| SMILES | CC.CCCCN1C(=O)CC[C@@H]1/C=C/CC(C)O |
| InChI | InChI=1S/C13H23NO2.C2H6/c1-3-4-10-14-12(8-9-13(14)16)7-5-6-11(2)15;1-2/h5,7,11-12,15H,3-4,6,8-10H2,1-2H3;1-2H3/b7-5+;/t11?,12-;/m0./s1 |
| InChIKey | YWTPMVBIPAXAAK-HIXBTEAASA-N |
| XLogP | 3.13 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|