C18H31NO4S — CID 10155288
4-[(2R)-2-[(E)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]butylsulfanyl acetate (PubChem CID 10155288) has the molecular formula C18H31NO4S and a molecular weight of 357.52 g/mol. Its IUPAC name is 4-[(2R)-2-[(E)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]butylsulfanyl acetate.
| Compound Name | 4-[(2R)-2-[(E)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]butylsulfanyl acetate |
|---|---|
| PubChem CID | 10155288 |
| Molecular Formula | C18H31NO4S |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 4-[(2R)-2-[(E)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]butylsulfanyl acetate |
| SMILES | CCCCCC(O)/C=C/[C@H]1CCC(=O)N1CCCCSOC(C)=O |
| InChI | InChI=1S/C18H31NO4S/c1-3-4-5-8-17(21)11-9-16-10-12-18(22)19(16)13-6-7-14-24-23-15(2)20/h9,11,16-17,21H,3-8,10,12-14H2,1-2H3/b11-9+/t16-,17?/m0/s1 |
| InChIKey | LZIWNDYMARVFIN-ASIWNESXSA-N |
| XLogP | 3.47 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|