C23H28FN3O4S3 — CID 177045240
2-[2-[(2R)-2-[(E,3S)-8-[(3-fluoro-2-pyridinyl)sulfanyl]-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 177045240) has the molecular formula C23H28FN3O4S3 and a molecular weight of 525.69 g/mol. Its IUPAC name is 2-[2-[(2R)-2-[(E,3S)-8-[(3-fluoro-2-pyridinyl)sulfanyl]-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-[(2R)-2-[(E,3S)-8-[(3-fluoro-2-pyridinyl)sulfanyl]-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 177045240 |
| Molecular Formula | C23H28FN3O4S3 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | 2-[2-[(2R)-2-[(E,3S)-8-[(3-fluoro-2-pyridinyl)sulfanyl]-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]ethylsulfanyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(SCCN2C(=O)CC[C@@H]2/C=C/[C@@H](O)CCCCCSc2ncccc2F)n1 |
| InChI | InChI=1S/C23H28FN3O4S3/c24-18-6-4-11-25-21(18)32-13-3-1-2-5-17(28)9-7-16-8-10-20(29)27(16)12-14-33-23-26-19(15-34-23)22(30)31/h4,6-7,9,11,15-17,28H,1-3,5,8,10,12-14H2,(H,30,31)/b9-7+/t16-,17-/m0/s1 |
| InChIKey | DEUNXNHYLJQTBE-NNTYKDFWSA-N |
| XLogP | 4.73 |
| TPSA | 103.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|