C19H31NO5 — CID 13366082
7-[2-[(E)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]-6-oxoheptanoic acid (PubChem CID 13366082) has the molecular formula C19H31NO5 and a molecular weight of 353.46 g/mol. Its IUPAC name is 7-[2-[(E)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]-6-oxoheptanoic acid.
| Compound Name | 7-[2-[(E)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]-6-oxoheptanoic acid |
|---|---|
| PubChem CID | 13366082 |
| Molecular Formula | C19H31NO5 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 7-[2-[(E)-3-hydroxyoct-1-enyl]-5-oxopyrrolidin-1-yl]-6-oxoheptanoic acid |
| SMILES | CCCCCC(O)/C=C/C1CCC(=O)N1CC(=O)CCCCC(=O)O |
| InChI | InChI=1S/C19H31NO5/c1-2-3-4-7-16(21)12-10-15-11-13-18(23)20(15)14-17(22)8-5-6-9-19(24)25/h10,12,15-16,21H,2-9,11,13-14H2,1H3,(H,24,25)/b12-10+ |
| InChIKey | OBOBMZIDOASWEG-ZRDIBKRKSA-N |
| XLogP | 2.69 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|