C18H29NO5 — CID 69355178
2-[4-[(2R)-2-(3-hydroxyoct-1-enyl)-5-oxopyrrolidin-1-yl]but-2-enoxy]acetic acid (PubChem CID 69355178) has the molecular formula C18H29NO5 and a molecular weight of 339.43 g/mol. Its IUPAC name is 2-[4-[(2R)-2-(3-hydroxyoct-1-enyl)-5-oxopyrrolidin-1-yl]but-2-enoxy]acetic acid.
| Compound Name | 2-[4-[(2R)-2-(3-hydroxyoct-1-enyl)-5-oxopyrrolidin-1-yl]but-2-enoxy]acetic acid |
|---|---|
| PubChem CID | 69355178 |
| Molecular Formula | C18H29NO5 |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 2-[4-[(2R)-2-(3-hydroxyoct-1-enyl)-5-oxopyrrolidin-1-yl]but-2-enoxy]acetic acid |
| SMILES | CCCCCC(O)C=C[C@H]1CCC(=O)N1CC=CCOCC(=O)O |
| InChI | InChI=1S/C18H29NO5/c1-2-3-4-7-16(20)10-8-15-9-11-17(21)19(15)12-5-6-13-24-14-18(22)23/h5-6,8,10,15-16,20H,2-4,7,9,11-14H2,1H3,(H,22,23)/t15-,16?/m0/s1 |
| InChIKey | ZMHVEYHSZFGHPD-VYRBHSGPSA-N |
| XLogP | 2.13 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|