C23H38N2O3 — CID 71121730
(Z)-N-cyclopropyl-7-[(2R)-2-[(E)-3-hydroxyoct-1-enyl]-6-oxopiperidin-1-yl]hept-5-enamide (PubChem CID 71121730) has the molecular formula C23H38N2O3 and a molecular weight of 390.57 g/mol. Its IUPAC name is (Z)-N-cyclopropyl-7-[(2R)-2-[(E)-3-hydroxyoct-1-enyl]-6-oxopiperidin-1-yl]hept-5-enamide.
| Compound Name | (Z)-N-cyclopropyl-7-[(2R)-2-[(E)-3-hydroxyoct-1-enyl]-6-oxopiperidin-1-yl]hept-5-enamide |
|---|---|
| PubChem CID | 71121730 |
| Molecular Formula | C23H38N2O3 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | (Z)-N-cyclopropyl-7-[(2R)-2-[(E)-3-hydroxyoct-1-enyl]-6-oxopiperidin-1-yl]hept-5-enamide |
| SMILES | CCCCCC(O)/C=C/[C@H]1CCCC(=O)N1C/C=C\CCCC(=O)NC1CC1 |
| InChI | InChI=1S/C23H38N2O3/c1-2-3-6-11-21(26)17-16-20-10-9-13-23(28)25(20)18-8-5-4-7-12-22(27)24-19-14-15-19/h5,8,16-17,19-21,26H,2-4,6-7,9-15,18H2,1H3,(H,24,27)/b8-5-,17-16+/t20-,21?/m1/s1 |
| InChIKey | KWKNIUSKSBZNMM-MHENZWHTSA-N |
| XLogP | 3.87 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|