C21H29NO6 — CID 71209732
(Z)-7-[(2R)-2-[(E)-3-hydroxy-4-(5-methoxyfuran-2-yl)but-1-enyl]-6-oxopiperidin-1-yl]hept-5-enoic acid (PubChem CID 71209732) has the molecular formula C21H29NO6 and a molecular weight of 391.46 g/mol. Its IUPAC name is (Z)-7-[(2R)-2-[(E)-3-hydroxy-4-(5-methoxyfuran-2-yl)but-1-enyl]-6-oxopiperidin-1-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(2R)-2-[(E)-3-hydroxy-4-(5-methoxyfuran-2-yl)but-1-enyl]-6-oxopiperidin-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 71209732 |
| Molecular Formula | C21H29NO6 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | (Z)-7-[(2R)-2-[(E)-3-hydroxy-4-(5-methoxyfuran-2-yl)but-1-enyl]-6-oxopiperidin-1-yl]hept-5-enoic acid |
| SMILES | COc1ccc(CC(O)/C=C/[C@H]2CCCC(=O)N2C/C=C\CCCC(=O)O)o1 |
| InChI | InChI=1S/C21H29NO6/c1-27-21-13-12-18(28-21)15-17(23)11-10-16-7-6-8-19(24)22(16)14-5-3-2-4-9-20(25)26/h3,5,10-13,16-17,23H,2,4,6-9,14-15H2,1H3,(H,25,26)/b5-3-,11-10+/t16-,17?/m1/s1 |
| InChIKey | FTWFRWKEUZHRHZ-OCMCZSOXSA-N |
| XLogP | 2.94 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|