C19H31NO5 — CID 162283320
7-[(2R)-2-(3-hydroxy-4-propoxybut-1-enyl)-6-oxopiperidin-1-yl]hept-5-enoic acid (PubChem CID 162283320) has the molecular formula C19H31NO5 and a molecular weight of 353.46 g/mol. Its IUPAC name is 7-[(2R)-2-(3-hydroxy-4-propoxybut-1-enyl)-6-oxopiperidin-1-yl]hept-5-enoic acid.
| Compound Name | 7-[(2R)-2-(3-hydroxy-4-propoxybut-1-enyl)-6-oxopiperidin-1-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 162283320 |
| Molecular Formula | C19H31NO5 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 7-[(2R)-2-(3-hydroxy-4-propoxybut-1-enyl)-6-oxopiperidin-1-yl]hept-5-enoic acid |
| SMILES | CCCOCC(O)C=C[C@H]1CCCC(=O)N1CC=CCCCC(=O)O |
| InChI | InChI=1S/C19H31NO5/c1-2-14-25-15-17(21)12-11-16-8-7-9-18(22)20(16)13-6-4-3-5-10-19(23)24/h4,6,11-12,16-17,21H,2-3,5,7-10,13-15H2,1H3,(H,23,24)/t16-,17?/m1/s1 |
| InChIKey | PDHDTMUVADTGHN-TZHYSIJRSA-N |
| XLogP | 2.52 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|