C20H35NO5 — CID 162281296
7-[(2R)-2-(3-hydroxy-3-methyl-4-propoxybut-1-enyl)-6-oxopiperidin-1-yl]heptanoic acid (PubChem CID 162281296) has the molecular formula C20H35NO5 and a molecular weight of 369.50 g/mol. Its IUPAC name is 7-[(2R)-2-(3-hydroxy-3-methyl-4-propoxybut-1-enyl)-6-oxopiperidin-1-yl]heptanoic acid.
| Compound Name | 7-[(2R)-2-(3-hydroxy-3-methyl-4-propoxybut-1-enyl)-6-oxopiperidin-1-yl]heptanoic acid |
|---|---|
| PubChem CID | 162281296 |
| Molecular Formula | C20H35NO5 |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.25 |
| IUPAC Name | 7-[(2R)-2-(3-hydroxy-3-methyl-4-propoxybut-1-enyl)-6-oxopiperidin-1-yl]heptanoic acid |
| SMILES | CCCOCC(C)(O)C=C[C@H]1CCCC(=O)N1CCCCCCC(=O)O |
| InChI | InChI=1S/C20H35NO5/c1-3-15-26-16-20(2,25)13-12-17-9-8-10-18(22)21(17)14-7-5-4-6-11-19(23)24/h12-13,17,25H,3-11,14-16H2,1-2H3,(H,23,24)/t17-,20?/m1/s1 |
| InChIKey | UUYXVJKPZWDLSI-DIAVIDTQSA-N |
| XLogP | 3.14 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|