C34H58N2O6 — CID 69023632
methyl 2,7-bis[2-(3-hydroxyoct-1-enyl)-6-oxopiperidin-1-yl]heptanoate (PubChem CID 69023632) has the molecular formula C34H58N2O6 and a molecular weight of 590.85 g/mol. Its IUPAC name is methyl 2,7-bis[2-(3-hydroxyoct-1-enyl)-6-oxopiperidin-1-yl]heptanoate.
| Compound Name | methyl 2,7-bis[2-(3-hydroxyoct-1-enyl)-6-oxopiperidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 69023632 |
| Molecular Formula | C34H58N2O6 |
| Molecular Weight | 590.85 g/mol |
| Exact Mass | 590.43 |
| IUPAC Name | methyl 2,7-bis[2-(3-hydroxyoct-1-enyl)-6-oxopiperidin-1-yl]heptanoate |
| SMILES | CCCCCC(O)C=CC1CCCC(=O)N1CCCCCC(C(=O)OC)N1C(=O)CCCC1C=CC(O)CCCCC |
| InChI | InChI=1S/C34H58N2O6/c1-4-6-9-17-29(37)24-22-27-15-13-20-32(39)35(27)26-12-8-11-19-31(34(41)42-3)36-28(16-14-21-33(36)40)23-25-30(38)18-10-7-5-2/h22-25,27-31,37-38H,4-21,26H2,1-3H3 |
| InChIKey | HUFUMCXIRZBYAP-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.85 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|