C19H38NO5P — CID 58804739
6-[(2R)-2-(3-hydroxyoctyl)-6-oxopiperidin-1-yl]hexylphosphonic acid (PubChem CID 58804739) has the molecular formula C19H38NO5P and a molecular weight of 391.49 g/mol. Its IUPAC name is 6-[(2R)-2-(3-hydroxyoctyl)-6-oxopiperidin-1-yl]hexylphosphonic acid.
| Compound Name | 6-[(2R)-2-(3-hydroxyoctyl)-6-oxopiperidin-1-yl]hexylphosphonic acid |
|---|---|
| PubChem CID | 58804739 |
| Molecular Formula | C19H38NO5P |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | 6-[(2R)-2-(3-hydroxyoctyl)-6-oxopiperidin-1-yl]hexylphosphonic acid |
| SMILES | CCCCCC(O)CC[C@H]1CCCC(=O)N1CCCCCCP(=O)(O)O |
| InChI | InChI=1S/C19H38NO5P/c1-2-3-6-11-18(21)14-13-17-10-9-12-19(22)20(17)15-7-4-5-8-16-26(23,24)25/h17-18,21H,2-16H2,1H3,(H2,23,24,25)/t17-,18?/m1/s1 |
| InChIKey | QZUKJWOKVNXMQA-QNSVNVJESA-N |
| XLogP | 3.83 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|