C22H35NO5 — CID 143235008
5-[(2R)-2-[(5Z,6Z)-5-ethylidene-3-hydroxynona-6,8-dienyl]-6-oxopiperidin-1-yl]pentyl hydrogen carbonate (PubChem CID 143235008) has the molecular formula C22H35NO5 and a molecular weight of 393.52 g/mol. Its IUPAC name is 5-[(2R)-2-[(5Z,6Z)-5-ethylidene-3-hydroxynona-6,8-dienyl]-6-oxopiperidin-1-yl]pentyl hydrogen carbonate.
| Compound Name | 5-[(2R)-2-[(5Z,6Z)-5-ethylidene-3-hydroxynona-6,8-dienyl]-6-oxopiperidin-1-yl]pentyl hydrogen carbonate |
|---|---|
| PubChem CID | 143235008 |
| Molecular Formula | C22H35NO5 |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | 5-[(2R)-2-[(5Z,6Z)-5-ethylidene-3-hydroxynona-6,8-dienyl]-6-oxopiperidin-1-yl]pentyl hydrogen carbonate |
| SMILES | C=C/C=C\C(=C/C)CC(O)CC[C@H]1CCCC(=O)N1CCCCCOC(=O)O |
| InChI | InChI=1S/C22H35NO5/c1-3-5-10-18(4-2)17-20(24)14-13-19-11-9-12-21(25)23(19)15-7-6-8-16-28-22(26)27/h3-5,10,19-20,24H,1,6-9,11-17H2,2H3,(H,26,27)/b10-5-,18-4+/t19-,20?/m1/s1 |
| InChIKey | QWDIIXIQAALCSO-OQXXMDPXSA-N |
| XLogP | 4.45 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|