C24H34N2O4 — CID 69269978
ethyl 7-[(2S)-2-[4-(3-cyanophenyl)-3-hydroxybutyl]-5-oxopyrrolidin-1-yl]heptanoate (PubChem CID 69269978) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is ethyl 7-[(2S)-2-[4-(3-cyanophenyl)-3-hydroxybutyl]-5-oxopyrrolidin-1-yl]heptanoate.
| Compound Name | ethyl 7-[(2S)-2-[4-(3-cyanophenyl)-3-hydroxybutyl]-5-oxopyrrolidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 69269978 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | ethyl 7-[(2S)-2-[4-(3-cyanophenyl)-3-hydroxybutyl]-5-oxopyrrolidin-1-yl]heptanoate |
| SMILES | CCOC(=O)CCCCCCN1C(=O)CC[C@@H]1CCC(O)Cc1cccc(C#N)c1 |
| InChI | InChI=1S/C24H34N2O4/c1-2-30-24(29)10-5-3-4-6-15-26-21(12-14-23(26)28)11-13-22(27)17-19-8-7-9-20(16-19)18-25/h7-9,16,21-22,27H,2-6,10-15,17H2,1H3/t21-,22?/m0/s1 |
| InChIKey | CBAYRYTVUIMING-HMTLIYDFSA-N |
| XLogP | 3.75 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|