C24H32F3NO4 — CID 20801281
ethyl 7-[2-oxo-5-[3-oxo-4-[3-(trifluoromethyl)phenyl]butyl]pyrrolidin-1-yl]heptanoate (PubChem CID 20801281) has the molecular formula C24H32F3NO4 and a molecular weight of 455.52 g/mol. Its IUPAC name is ethyl 7-[2-oxo-5-[3-oxo-4-[3-(trifluoromethyl)phenyl]butyl]pyrrolidin-1-yl]heptanoate.
| Compound Name | ethyl 7-[2-oxo-5-[3-oxo-4-[3-(trifluoromethyl)phenyl]butyl]pyrrolidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 20801281 |
| Molecular Formula | C24H32F3NO4 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | ethyl 7-[2-oxo-5-[3-oxo-4-[3-(trifluoromethyl)phenyl]butyl]pyrrolidin-1-yl]heptanoate |
| SMILES | CCOC(=O)CCCCCCN1C(=O)CCC1CCC(=O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H32F3NO4/c1-2-32-23(31)10-5-3-4-6-15-28-20(12-14-22(28)30)11-13-21(29)17-18-8-7-9-19(16-18)24(25,26)27/h7-9,16,20H,2-6,10-15,17H2,1H3 |
| InChIKey | WIAFNUCNEGYUMU-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|