C24H32F3NO5 — CID 69269950
ethyl 7-[2-[(Z)-1-hydroxy-4-[3-(trifluoromethoxy)phenyl]but-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate (PubChem CID 69269950) has the molecular formula C24H32F3NO5 and a molecular weight of 471.52 g/mol. Its IUPAC name is ethyl 7-[2-[(Z)-1-hydroxy-4-[3-(trifluoromethoxy)phenyl]but-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate.
| Compound Name | ethyl 7-[2-[(Z)-1-hydroxy-4-[3-(trifluoromethoxy)phenyl]but-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate |
|---|---|
| PubChem CID | 69269950 |
| Molecular Formula | C24H32F3NO5 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | ethyl 7-[2-[(Z)-1-hydroxy-4-[3-(trifluoromethoxy)phenyl]but-1-enyl]-5-oxopyrrolidin-1-yl]heptanoate |
| SMILES | CCOC(=O)CCCCCCN1C(=O)CCC1/C(O)=C/CCc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C24H32F3NO5/c1-2-32-23(31)13-5-3-4-6-16-28-20(14-15-22(28)30)21(29)12-8-10-18-9-7-11-19(17-18)33-24(25,26)27/h7,9,11-12,17,20,29H,2-6,8,10,13-16H2,1H3/b21-12- |
| InChIKey | CZHHOVSIPJBYMF-MTJSOVHGSA-N |
| XLogP | 5.46 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|