C21H28F3N3O2 — CID 26358563
(5R)-1-[3-(2-oxopyrrolidin-1-yl)propyl]-5-[2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]pyrrolidin-2-one (PubChem CID 26358563) has the molecular formula C21H28F3N3O2 and a molecular weight of 411.47 g/mol. Its IUPAC name is (5R)-1-[3-(2-oxopyrrolidin-1-yl)propyl]-5-[2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]pyrrolidin-2-one.
| Compound Name | (5R)-1-[3-(2-oxopyrrolidin-1-yl)propyl]-5-[2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 26358563 |
| Molecular Formula | C21H28F3N3O2 |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | (5R)-1-[3-(2-oxopyrrolidin-1-yl)propyl]-5-[2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1CCCN1C(=O)CC[C@@H]1CCNCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H28F3N3O2/c22-21(23,24)17-5-1-4-16(14-17)15-25-10-9-18-7-8-20(29)27(18)13-3-12-26-11-2-6-19(26)28/h1,4-5,14,18,25H,2-3,6-13,15H2/t18-/m1/s1 |
| InChIKey | ITHRNBPTKQLNIY-GOSISDBHSA-N |
| XLogP | 3.19 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|