C22H30F3N3O3 — CID 45237869
ethyl 4-[2-oxo-5-[2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]pyrrolidin-1-yl]piperidine-1-carboxylate (PubChem CID 45237869) has the molecular formula C22H30F3N3O3 and a molecular weight of 441.49 g/mol. Its IUPAC name is ethyl 4-[2-oxo-5-[2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]pyrrolidin-1-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[2-oxo-5-[2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]pyrrolidin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 45237869 |
| Molecular Formula | C22H30F3N3O3 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | ethyl 4-[2-oxo-5-[2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]pyrrolidin-1-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2C(=O)CCC2CCNCc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H30F3N3O3/c1-2-31-21(30)27-12-9-19(10-13-27)28-18(6-7-20(28)29)8-11-26-15-16-4-3-5-17(14-16)22(23,24)25/h3-5,14,18-19,26H,2,6-13,15H2,1H3 |
| InChIKey | LGLQMXUQLQYDEV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|