C19H25F3N2O — CID 31074339
(5S)-1-cyclopentyl-5-[2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]pyrrolidin-2-one (PubChem CID 31074339) has the molecular formula C19H25F3N2O and a molecular weight of 354.42 g/mol. Its IUPAC name is (5S)-1-cyclopentyl-5-[2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]pyrrolidin-2-one.
| Compound Name | (5S)-1-cyclopentyl-5-[2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 31074339 |
| Molecular Formula | C19H25F3N2O |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (5S)-1-cyclopentyl-5-[2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@@H](CCNCc2cccc(C(F)(F)F)c2)N1C1CCCC1 |
| InChI | InChI=1S/C19H25F3N2O/c20-19(21,22)15-5-3-4-14(12-15)13-23-11-10-17-8-9-18(25)24(17)16-6-1-2-7-16/h3-5,12,16-17,23H,1-2,6-11,13H2/t17-/m0/s1 |
| InChIKey | LCEMDQPUDMLQKX-KRWDZBQOSA-N |
| XLogP | 4.12 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|