C22H22ClF3N4O — CID 42483775
(5S)-1-[(6-chloro-1H-benzimidazol-2-yl)methyl]-5-[2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]pyrrolidin-2-one (PubChem CID 42483775) has the molecular formula C22H22ClF3N4O and a molecular weight of 450.89 g/mol. Its IUPAC name is (5S)-1-[(6-chloro-1H-benzimidazol-2-yl)methyl]-5-[2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]pyrrolidin-2-one.
| Compound Name | (5S)-1-[(6-chloro-1H-benzimidazol-2-yl)methyl]-5-[2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 42483775 |
| Molecular Formula | C22H22ClF3N4O |
| Molecular Weight | 450.89 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | (5S)-1-[(6-chloro-1H-benzimidazol-2-yl)methyl]-5-[2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@@H](CCNCc2cccc(C(F)(F)F)c2)N1Cc1nc2ccc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C22H22ClF3N4O/c23-16-4-6-18-19(11-16)29-20(28-18)13-30-17(5-7-21(30)31)8-9-27-12-14-2-1-3-15(10-14)22(24,25)26/h1-4,6,10-11,17,27H,5,7-9,12-13H2,(H,28,29)/t17-/m0/s1 |
| InChIKey | SDQJFYCIWSKRNG-KRWDZBQOSA-N |
| XLogP | 4.91 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.89 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|