C20H21F4N3O — CID 125165519
(5S)-1-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-5-[2-(pyridin-2-ylmethylamino)ethyl]pyrrolidin-2-one (PubChem CID 125165519) has the molecular formula C20H21F4N3O and a molecular weight of 395.40 g/mol. Its IUPAC name is (5S)-1-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-5-[2-(pyridin-2-ylmethylamino)ethyl]pyrrolidin-2-one.
| Compound Name | (5S)-1-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-5-[2-(pyridin-2-ylmethylamino)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 125165519 |
| Molecular Formula | C20H21F4N3O |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | (5S)-1-[[2-fluoro-5-(trifluoromethyl)phenyl]methyl]-5-[2-(pyridin-2-ylmethylamino)ethyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@@H](CCNCc2ccccn2)N1Cc1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C20H21F4N3O/c21-18-6-4-15(20(22,23)24)11-14(18)13-27-17(5-7-19(27)28)8-10-25-12-16-3-1-2-9-26-16/h1-4,6,9,11,17,25H,5,7-8,10,12-13H2/t17-/m0/s1 |
| InChIKey | KFDQEGDVEFXYPS-KRWDZBQOSA-N |
| XLogP | 3.91 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|