C20H21F3N2O — CID 42239593
(5S)-1-[(2,5-difluorophenyl)methyl]-5-[2-[(4-fluorophenyl)methylamino]ethyl]pyrrolidin-2-one (PubChem CID 42239593) has the molecular formula C20H21F3N2O and a molecular weight of 362.39 g/mol. Its IUPAC name is (5S)-1-[(2,5-difluorophenyl)methyl]-5-[2-[(4-fluorophenyl)methylamino]ethyl]pyrrolidin-2-one.
| Compound Name | (5S)-1-[(2,5-difluorophenyl)methyl]-5-[2-[(4-fluorophenyl)methylamino]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 42239593 |
| Molecular Formula | C20H21F3N2O |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | (5S)-1-[(2,5-difluorophenyl)methyl]-5-[2-[(4-fluorophenyl)methylamino]ethyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@@H](CCNCc2ccc(F)cc2)N1Cc1cc(F)ccc1F |
| InChI | InChI=1S/C20H21F3N2O/c21-16-3-1-14(2-4-16)12-24-10-9-18-6-8-20(26)25(18)13-15-11-17(22)5-7-19(15)23/h1-5,7,11,18,24H,6,8-10,12-13H2/t18-/m0/s1 |
| InChIKey | CMAFDXRONKCVKN-SFHVURJKSA-N |
| XLogP | 3.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|