C20H22F2N2O — CID 42377292
(5R)-1-[(3-fluorophenyl)methyl]-5-[2-[(2-fluorophenyl)methylamino]ethyl]pyrrolidin-2-one (PubChem CID 42377292) has the molecular formula C20H22F2N2O and a molecular weight of 344.40 g/mol. Its IUPAC name is (5R)-1-[(3-fluorophenyl)methyl]-5-[2-[(2-fluorophenyl)methylamino]ethyl]pyrrolidin-2-one.
| Compound Name | (5R)-1-[(3-fluorophenyl)methyl]-5-[2-[(2-fluorophenyl)methylamino]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 42377292 |
| Molecular Formula | C20H22F2N2O |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (5R)-1-[(3-fluorophenyl)methyl]-5-[2-[(2-fluorophenyl)methylamino]ethyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@H](CCNCc2ccccc2F)N1Cc1cccc(F)c1 |
| InChI | InChI=1S/C20H22F2N2O/c21-17-6-3-4-15(12-17)14-24-18(8-9-20(24)25)10-11-23-13-16-5-1-2-7-19(16)22/h1-7,12,18,23H,8-11,13-14H2/t18-/m1/s1 |
| InChIKey | YNQQNQFDQIMHOO-GOSISDBHSA-N |
| XLogP | 3.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|