C24H36FN3O — CID 26354045
(5S)-5-[2-[(2-fluorophenyl)methylamino]ethyl]-1-[(1-piperidin-1-ylcyclopentyl)methyl]pyrrolidin-2-one (PubChem CID 26354045) has the molecular formula C24H36FN3O and a molecular weight of 401.57 g/mol. Its IUPAC name is (5S)-5-[2-[(2-fluorophenyl)methylamino]ethyl]-1-[(1-piperidin-1-ylcyclopentyl)methyl]pyrrolidin-2-one.
| Compound Name | (5S)-5-[2-[(2-fluorophenyl)methylamino]ethyl]-1-[(1-piperidin-1-ylcyclopentyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 26354045 |
| Molecular Formula | C24H36FN3O |
| Molecular Weight | 401.57 g/mol |
| Exact Mass | 401.28 |
| IUPAC Name | (5S)-5-[2-[(2-fluorophenyl)methylamino]ethyl]-1-[(1-piperidin-1-ylcyclopentyl)methyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@@H](CCNCc2ccccc2F)N1CC1(N2CCCCC2)CCCC1 |
| InChI | InChI=1S/C24H36FN3O/c25-22-9-3-2-8-20(22)18-26-15-12-21-10-11-23(29)28(21)19-24(13-4-5-14-24)27-16-6-1-7-17-27/h2-3,8-9,21,26H,1,4-7,10-19H2/t21-/m0/s1 |
| InChIKey | GEDZGYUAGOTQDZ-NRFANRHFSA-N |
| XLogP | 4.10 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.57 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|