C25H33FN4O — CID 42383166
(5R)-5-[2-[(2-fluorophenyl)methylamino]ethyl]-1-[(2S)-2-piperidin-1-yl-2-pyridin-3-ylethyl]pyrrolidin-2-one (PubChem CID 42383166) has the molecular formula C25H33FN4O and a molecular weight of 424.56 g/mol. Its IUPAC name is (5R)-5-[2-[(2-fluorophenyl)methylamino]ethyl]-1-[(2S)-2-piperidin-1-yl-2-pyridin-3-ylethyl]pyrrolidin-2-one.
| Compound Name | (5R)-5-[2-[(2-fluorophenyl)methylamino]ethyl]-1-[(2S)-2-piperidin-1-yl-2-pyridin-3-ylethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 42383166 |
| Molecular Formula | C25H33FN4O |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | (5R)-5-[2-[(2-fluorophenyl)methylamino]ethyl]-1-[(2S)-2-piperidin-1-yl-2-pyridin-3-ylethyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@H](CCNCc2ccccc2F)N1C[C@H](c1cccnc1)N1CCCCC1 |
| InChI | InChI=1S/C25H33FN4O/c26-23-9-3-2-7-20(23)17-28-14-12-22-10-11-25(31)30(22)19-24(21-8-6-13-27-18-21)29-15-4-1-5-16-29/h2-3,6-9,13,18,22,24,28H,1,4-5,10-12,14-17,19H2/t22-,24-/m1/s1 |
| InChIKey | CDJVABFBWVRXFK-ISKFKSNPSA-N |
| XLogP | 3.92 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|