C22H25FN2O — CID 42452055
(5S)-1-(2,3-dihydro-1H-inden-2-yl)-5-[2-[(2-fluorophenyl)methylamino]ethyl]pyrrolidin-2-one (PubChem CID 42452055) has the molecular formula C22H25FN2O and a molecular weight of 352.45 g/mol. Its IUPAC name is (5S)-1-(2,3-dihydro-1H-inden-2-yl)-5-[2-[(2-fluorophenyl)methylamino]ethyl]pyrrolidin-2-one.
| Compound Name | (5S)-1-(2,3-dihydro-1H-inden-2-yl)-5-[2-[(2-fluorophenyl)methylamino]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 42452055 |
| Molecular Formula | C22H25FN2O |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (5S)-1-(2,3-dihydro-1H-inden-2-yl)-5-[2-[(2-fluorophenyl)methylamino]ethyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@@H](CCNCc2ccccc2F)N1C1Cc2ccccc2C1 |
| InChI | InChI=1S/C22H25FN2O/c23-21-8-4-3-7-18(21)15-24-12-11-19-9-10-22(26)25(19)20-13-16-5-1-2-6-17(16)14-20/h1-8,19-20,24H,9-15H2/t19-/m0/s1 |
| InChIKey | DLGXAZAFYWIFEM-IBGZPJMESA-N |
| XLogP | 3.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|