C21H21ClF2N2O3 — CID 42371726
(5S)-5-[2-[(6-chloro-1,3-benzodioxol-5-yl)methylamino]ethyl]-1-[(2,3-difluorophenyl)methyl]pyrrolidin-2-one (PubChem CID 42371726) has the molecular formula C21H21ClF2N2O3 and a molecular weight of 422.86 g/mol. Its IUPAC name is (5S)-5-[2-[(6-chloro-1,3-benzodioxol-5-yl)methylamino]ethyl]-1-[(2,3-difluorophenyl)methyl]pyrrolidin-2-one.
| Compound Name | (5S)-5-[2-[(6-chloro-1,3-benzodioxol-5-yl)methylamino]ethyl]-1-[(2,3-difluorophenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 42371726 |
| Molecular Formula | C21H21ClF2N2O3 |
| Molecular Weight | 422.86 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | (5S)-5-[2-[(6-chloro-1,3-benzodioxol-5-yl)methylamino]ethyl]-1-[(2,3-difluorophenyl)methyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@@H](CCNCc2cc3c(cc2Cl)OCO3)N1Cc1cccc(F)c1F |
| InChI | InChI=1S/C21H21ClF2N2O3/c22-16-9-19-18(28-12-29-19)8-14(16)10-25-7-6-15-4-5-20(27)26(15)11-13-2-1-3-17(23)21(13)24/h1-3,8-9,15,25H,4-7,10-12H2/t15-/m0/s1 |
| InChIKey | NDAFQJCALMFBHF-HNNXBMFYSA-N |
| XLogP | 4.02 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.86 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|