C22H25ClN2O4 — CID 26342827
(5S)-5-[2-[(6-chloro-1,3-benzodioxol-5-yl)methylamino]ethyl]-1-[(3-methoxyphenyl)methyl]pyrrolidin-2-one (PubChem CID 26342827) has the molecular formula C22H25ClN2O4 and a molecular weight of 416.91 g/mol. Its IUPAC name is (5S)-5-[2-[(6-chloro-1,3-benzodioxol-5-yl)methylamino]ethyl]-1-[(3-methoxyphenyl)methyl]pyrrolidin-2-one.
| Compound Name | (5S)-5-[2-[(6-chloro-1,3-benzodioxol-5-yl)methylamino]ethyl]-1-[(3-methoxyphenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 26342827 |
| Molecular Formula | C22H25ClN2O4 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | (5S)-5-[2-[(6-chloro-1,3-benzodioxol-5-yl)methylamino]ethyl]-1-[(3-methoxyphenyl)methyl]pyrrolidin-2-one |
| SMILES | COc1cccc(CN2C(=O)CC[C@H]2CCNCc2cc3c(cc2Cl)OCO3)c1 |
| InChI | InChI=1S/C22H25ClN2O4/c1-27-18-4-2-3-15(9-18)13-25-17(5-6-22(25)26)7-8-24-12-16-10-20-21(11-19(16)23)29-14-28-20/h2-4,9-11,17,24H,5-8,12-14H2,1H3/t17-/m0/s1 |
| InChIKey | DEFRAKHAPCZYJF-KRWDZBQOSA-N |
| XLogP | 3.75 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|