C22H24ClFN2O3 — CID 26321183
(5R)-5-[2-[(6-chloro-1,3-benzodioxol-5-yl)methylamino]ethyl]-1-[2-(2-fluorophenyl)ethyl]pyrrolidin-2-one (PubChem CID 26321183) has the molecular formula C22H24ClFN2O3 and a molecular weight of 418.90 g/mol. Its IUPAC name is (5R)-5-[2-[(6-chloro-1,3-benzodioxol-5-yl)methylamino]ethyl]-1-[2-(2-fluorophenyl)ethyl]pyrrolidin-2-one.
| Compound Name | (5R)-5-[2-[(6-chloro-1,3-benzodioxol-5-yl)methylamino]ethyl]-1-[2-(2-fluorophenyl)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 26321183 |
| Molecular Formula | C22H24ClFN2O3 |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | (5R)-5-[2-[(6-chloro-1,3-benzodioxol-5-yl)methylamino]ethyl]-1-[2-(2-fluorophenyl)ethyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@H](CCNCc2cc3c(cc2Cl)OCO3)N1CCc1ccccc1F |
| InChI | InChI=1S/C22H24ClFN2O3/c23-18-12-21-20(28-14-29-21)11-16(18)13-25-9-7-17-5-6-22(27)26(17)10-8-15-3-1-2-4-19(15)24/h1-4,11-12,17,25H,5-10,13-14H2/t17-/m1/s1 |
| InChIKey | RSLFTPMNDYTWIQ-QGZVFWFLSA-N |
| XLogP | 3.92 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|