C21H25FN2O — CID 42235949
(5R)-5-[2-[(4-fluorophenyl)methylamino]ethyl]-1-[(2-methylphenyl)methyl]pyrrolidin-2-one (PubChem CID 42235949) has the molecular formula C21H25FN2O and a molecular weight of 340.44 g/mol. Its IUPAC name is (5R)-5-[2-[(4-fluorophenyl)methylamino]ethyl]-1-[(2-methylphenyl)methyl]pyrrolidin-2-one.
| Compound Name | (5R)-5-[2-[(4-fluorophenyl)methylamino]ethyl]-1-[(2-methylphenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 42235949 |
| Molecular Formula | C21H25FN2O |
| Molecular Weight | 340.44 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (5R)-5-[2-[(4-fluorophenyl)methylamino]ethyl]-1-[(2-methylphenyl)methyl]pyrrolidin-2-one |
| SMILES | Cc1ccccc1CN1C(=O)CC[C@@H]1CCNCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H25FN2O/c1-16-4-2-3-5-18(16)15-24-20(10-11-21(24)25)12-13-23-14-17-6-8-19(22)9-7-17/h2-9,20,23H,10-15H2,1H3/t20-/m1/s1 |
| InChIKey | ZTTNLBSZRSIKOQ-HXUWFJFHSA-N |
| XLogP | 3.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|