C21H27N3O — CID 42247085
(5R)-1-[(2S)-2-phenylpropyl]-5-[2-(pyridin-3-ylmethylamino)ethyl]pyrrolidin-2-one (PubChem CID 42247085) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is (5R)-1-[(2S)-2-phenylpropyl]-5-[2-(pyridin-3-ylmethylamino)ethyl]pyrrolidin-2-one.
| Compound Name | (5R)-1-[(2S)-2-phenylpropyl]-5-[2-(pyridin-3-ylmethylamino)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 42247085 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | (5R)-1-[(2S)-2-phenylpropyl]-5-[2-(pyridin-3-ylmethylamino)ethyl]pyrrolidin-2-one |
| SMILES | C[C@H](CN1C(=O)CC[C@@H]1CCNCc1cccnc1)c1ccccc1 |
| InChI | InChI=1S/C21H27N3O/c1-17(19-7-3-2-4-8-19)16-24-20(9-10-21(24)25)11-13-23-15-18-6-5-12-22-14-18/h2-8,12,14,17,20,23H,9-11,13,15-16H2,1H3/t17-,20-/m1/s1 |
| InChIKey | MJPOPKQFHXFYQG-YLJYHZDGSA-N |
| XLogP | 3.36 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|