C22H29N3O — CID 125158594
(5S)-5-[2-(pyridin-3-ylmethylamino)ethyl]-1-[[(1R,2S,4S)-spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-yl]methyl]pyrrolidin-2-one (PubChem CID 125158594) has the molecular formula C22H29N3O and a molecular weight of 351.49 g/mol. Its IUPAC name is (5S)-5-[2-(pyridin-3-ylmethylamino)ethyl]-1-[[(1R,2S,4S)-spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-yl]methyl]pyrrolidin-2-one.
| Compound Name | (5S)-5-[2-(pyridin-3-ylmethylamino)ethyl]-1-[[(1R,2S,4S)-spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-yl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 125158594 |
| Molecular Formula | C22H29N3O |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.23 |
| IUPAC Name | (5S)-5-[2-(pyridin-3-ylmethylamino)ethyl]-1-[[(1R,2S,4S)-spiro[bicyclo[2.2.1]hept-5-ene-7,1'-cyclopropane]-2-yl]methyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@@H](CCNCc2cccnc2)N1C[C@H]1C[C@H]2C=C[C@H]1C21CC1 |
| InChI | InChI=1S/C22H29N3O/c26-21-6-4-19(7-11-24-14-16-2-1-10-23-13-16)25(21)15-17-12-18-3-5-20(17)22(18)8-9-22/h1-3,5,10,13,17-20,24H,4,6-9,11-12,14-15H2/t17-,18-,19+,20-/m1/s1 |
| InChIKey | VDCZSTPMYIZDGA-YSTOQKLRSA-N |
| XLogP | 3.15 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|